C18H21F3O7S — CID 158223405
2-[3-(cyclohexanecarbonyloxy)-4-methylbenzoyl]oxy-3,3,3-trifluoropropane-1-sulfonic acid (PubChem CID 158223405) has the molecular formula C18H21F3O7S and a molecular weight of 438.42 g/mol. Its IUPAC name is 2-[3-(cyclohexanecarbonyloxy)-4-methylbenzoyl]oxy-3,3,3-trifluoropropane-1-sulfonic acid.
| Compound Name | 2-[3-(cyclohexanecarbonyloxy)-4-methylbenzoyl]oxy-3,3,3-trifluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 158223405 |
| Molecular Formula | C18H21F3O7S |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 2-[3-(cyclohexanecarbonyloxy)-4-methylbenzoyl]oxy-3,3,3-trifluoropropane-1-sulfonic acid |
| SMILES | Cc1ccc(C(=O)OC(CS(=O)(=O)O)C(F)(F)F)cc1OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C18H21F3O7S/c1-11-7-8-13(9-14(11)27-16(22)12-5-3-2-4-6-12)17(23)28-15(18(19,20)21)10-29(24,25)26/h7-9,12,15H,2-6,10H2,1H3,(H,24,25,26) |
| InChIKey | CNBWSSRGHBDANP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|