C32H39Ga — CID 177407972
11-(2,4,6-tritert-butylphenyl)benzo[b][1]benzogallepine (PubChem CID 177407972) has the molecular formula C32H39Ga and a molecular weight of 493.39 g/mol. Its IUPAC name is 11-(2,4,6-tritert-butylphenyl)benzo[b][1]benzogallepine.
| Compound Name | 11-(2,4,6-tritert-butylphenyl)benzo[b][1]benzogallepine |
|---|---|
| PubChem CID | 177407972 |
| Molecular Formula | C32H39Ga |
| Molecular Weight | 493.39 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 11-(2,4,6-tritert-butylphenyl)benzo[b][1]benzogallepine |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c([Ga]2c3ccccc3C=Cc3ccccc32)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H29.C14H10.Ga/c1-16(2,3)13-10-14(17(4,5)6)12-15(11-13)18(7,8)9;1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;/h10-11H,1-9H3;1-7,9,11-12H;/b;12-11-; |
| InChIKey | TWXYMAWXYIPZIX-SWPBDETKSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.39 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|