C18H28NO+ — CID 20783552
(3E)-5,7-ditert-butyl-3-propylidene-2H-1,3-benzoxazol-3-ium (PubChem CID 20783552) has the molecular formula C18H28NO+ and a molecular weight of 274.43 g/mol. Its IUPAC name is (3E)-5,7-ditert-butyl-3-propylidene-2H-1,3-benzoxazol-3-ium.
| Compound Name | (3E)-5,7-ditert-butyl-3-propylidene-2H-1,3-benzoxazol-3-ium |
|---|---|
| PubChem CID | 20783552 |
| Molecular Formula | C18H28NO+ |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | (3E)-5,7-ditert-butyl-3-propylidene-2H-1,3-benzoxazol-3-ium |
| SMILES | CC/C=[N+]1/COc2c1cc(C(C)(C)C)cc2C(C)(C)C |
| InChI | InChI=1S/C18H28NO/c1-8-9-19-12-20-16-14(18(5,6)7)10-13(11-15(16)19)17(2,3)4/h9-11H,8,12H2,1-7H3/q+1/b19-9- |
| InChIKey | GDFKNMHXAMPILX-OCKHKDLRSA-N |
| XLogP | 4.76 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'tert_butyl_A(2)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|