C34H52B2N2O4+2 — CID 148596926
6,8-ditert-butyl-3-[2-(6,8-ditert-butyl-2-methoxy-1,3,2-benzoxazaborinin-3-ium-3-yl)ethyl]-2-methoxy-1,3,2-benzoxazaborinin-3-ium (PubChem CID 148596926) has the molecular formula C34H52B2N2O4+2 and a molecular weight of 574.42 g/mol. Its IUPAC name is 6,8-ditert-butyl-3-[2-(6,8-ditert-butyl-2-methoxy-1,3,2-benzoxazaborinin-3-ium-3-yl)ethyl]-2-methoxy-1,3,2-benzoxazaborinin-3-ium.
| Compound Name | 6,8-ditert-butyl-3-[2-(6,8-ditert-butyl-2-methoxy-1,3,2-benzoxazaborinin-3-ium-3-yl)ethyl]-2-methoxy-1,3,2-benzoxazaborinin-3-ium |
|---|---|
| PubChem CID | 148596926 |
| Molecular Formula | C34H52B2N2O4+2 |
| Molecular Weight | 574.42 g/mol |
| Exact Mass | 574.41 |
| IUPAC Name | 6,8-ditert-butyl-3-[2-(6,8-ditert-butyl-2-methoxy-1,3,2-benzoxazaborinin-3-ium-3-yl)ethyl]-2-methoxy-1,3,2-benzoxazaborinin-3-ium |
| SMILES | COB1Oc2c(cc(C(C)(C)C)cc2C(C)(C)C)C=[N+]1CC[N+]1=Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2OB1OC |
| InChI | InChI=1S/C34H52B2N2O4/c1-31(2,3)25-17-23-21-37(35(39-13)41-29(23)27(19-25)33(7,8)9)15-16-38-22-24-18-26(32(4,5)6)20-28(34(10,11)12)30(24)42-36(38)40-14/h17-22H,15-16H2,1-14H3/q+2 |
| InChIKey | FVPJEGQKLZQPMQ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 42.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.42 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|