C18H27BBrNO2 — CID 139138644
(1R)-1-bromo-4,6-ditert-butyl-2,14-dioxa-10-azonia-1-boranuidatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9-tetraene (PubChem CID 139138644) has the molecular formula C18H27BBrNO2 and a molecular weight of 380.14 g/mol. Its IUPAC name is (1R)-1-bromo-4,6-ditert-butyl-2,14-dioxa-10-azonia-1-boranuidatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9-tetraene.
| Compound Name | (1R)-1-bromo-4,6-ditert-butyl-2,14-dioxa-10-azonia-1-boranuidatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9-tetraene |
|---|---|
| PubChem CID | 139138644 |
| Molecular Formula | C18H27BBrNO2 |
| Molecular Weight | 380.14 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | (1R)-1-bromo-4,6-ditert-butyl-2,14-dioxa-10-azonia-1-boranuidatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9-tetraene |
| SMILES | CC(C)(C)c1cc2c(c(C(C)(C)C)c1)O[B@-]1(Br)OCCC[N+]1=C2 |
| InChI | InChI=1S/C18H27BBrNO2/c1-17(2,3)14-10-13-12-21-8-7-9-22-19(21,20)23-16(13)15(11-14)18(4,5)6/h10-12H,7-9H2,1-6H3/t19-/m0/s1 |
| InChIKey | FEENJYRCYUJVBM-IBGZPJMESA-N |
| XLogP | 4.36 |
| TPSA | 21.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.14 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|