C22H37P — CID 164685833
(1R,2S)-2-ethyl-1-(2,4,6-tritert-butylphenyl)phosphirane (PubChem CID 164685833) has the molecular formula C22H37P and a molecular weight of 332.51 g/mol. Its IUPAC name is (1R,2S)-2-ethyl-1-(2,4,6-tritert-butylphenyl)phosphirane.
| Compound Name | (1R,2S)-2-ethyl-1-(2,4,6-tritert-butylphenyl)phosphirane |
|---|---|
| PubChem CID | 164685833 |
| Molecular Formula | C22H37P |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | (1R,2S)-2-ethyl-1-(2,4,6-tritert-butylphenyl)phosphirane |
| SMILES | CC[C@H]1C[P@@]1c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C22H37P/c1-11-16-14-23(16)19-17(21(5,6)7)12-15(20(2,3)4)13-18(19)22(8,9)10/h12-13,16H,11,14H2,1-10H3/t16-,23+/m0/s1 |
| InChIKey | HOSZGMBVSQTKPY-QMHKHESXSA-N |
| XLogP | 6.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|