C39H41BF10NP — CID 139041967
bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-yl-[2-[(1R,2R)-1-(2,4,6-tritert-butylphenyl)phosphiran-2-yl]ethyl]boranuide (PubChem CID 139041967) has the molecular formula C39H41BF10NP and a molecular weight of 755.53 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-yl-[2-[(1R,2R)-1-(2,4,6-tritert-butylphenyl)phosphiran-2-yl]ethyl]boranuide.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-yl-[2-[(1R,2R)-1-(2,4,6-tritert-butylphenyl)phosphiran-2-yl]ethyl]boranuide |
|---|---|
| PubChem CID | 139041967 |
| Molecular Formula | C39H41BF10NP |
| Molecular Weight | 755.53 g/mol |
| Exact Mass | 755.29 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-yl-[2-[(1R,2R)-1-(2,4,6-tritert-butylphenyl)phosphiran-2-yl]ethyl]boranuide |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c([P@]2C[C@H]2CC[B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)[n+]2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C39H41BF10NP/c1-37(2,3)20-17-22(38(4,5)6)36(23(18-20)39(7,8)9)52-19-21(52)13-14-40(51-15-11-10-12-16-51,24-26(41)30(45)34(49)31(46)27(24)42)25-28(43)32(47)35(50)33(48)29(25)44/h10-12,15-18,21H,13-14,19H2,1-9H3/t21-,52-/m1/s1 |
| InChIKey | VMCKCBQWNVGGSU-RSGBJMIMSA-N |
| XLogP | 9.45 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.53 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|