C32H11BF20NP — CID 139160055
[(2R)-2-bis(2,3,4,5,6-pentafluorophenyl)phosphanylpropyl]-bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide (PubChem CID 139160055) has the molecular formula C32H11BF20NP and a molecular weight of 831.19 g/mol. Its IUPAC name is [(2R)-2-bis(2,3,4,5,6-pentafluorophenyl)phosphanylpropyl]-bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide.
| Compound Name | [(2R)-2-bis(2,3,4,5,6-pentafluorophenyl)phosphanylpropyl]-bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide |
|---|---|
| PubChem CID | 139160055 |
| Molecular Formula | C32H11BF20NP |
| Molecular Weight | 831.19 g/mol |
| Exact Mass | 831.04 |
| IUPAC Name | [(2R)-2-bis(2,3,4,5,6-pentafluorophenyl)phosphanylpropyl]-bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide |
| SMILES | C[C@H](C[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)[n+]1ccccc1)P(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C32H11BF20NP/c1-8(55(31-27(50)23(46)21(44)24(47)28(31)51)32-29(52)25(48)22(45)26(49)30(32)53)7-33(54-5-3-2-4-6-54,9-11(34)15(38)19(42)16(39)12(9)35)10-13(36)17(40)20(43)18(41)14(10)37/h2-6,8H,7H2,1H3/t8-/m1/s1 |
| InChIKey | GAKVEIKAAGVTCV-MRVPVSSYSA-N |
| XLogP | 7.89 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.19 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|