C51H57BF5NP2 — CID 139159105
bis[2-bis(2,4,6-trimethylphenyl)phosphanylethyl]-(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide (PubChem CID 139159105) has the molecular formula C51H57BF5NP2 and a molecular weight of 851.77 g/mol. Its IUPAC name is bis[2-bis(2,4,6-trimethylphenyl)phosphanylethyl]-(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide.
| Compound Name | bis[2-bis(2,4,6-trimethylphenyl)phosphanylethyl]-(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide |
|---|---|
| PubChem CID | 139159105 |
| Molecular Formula | C51H57BF5NP2 |
| Molecular Weight | 851.77 g/mol |
| Exact Mass | 851.40 |
| IUPAC Name | bis[2-bis(2,4,6-trimethylphenyl)phosphanylethyl]-(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide |
| SMILES | Cc1cc(C)c(P(CC[B-](CCP(c2c(C)cc(C)cc2C)c2c(C)cc(C)cc2C)(c2c(F)c(F)c(F)c(F)c2F)[n+]2ccccc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C51H57BF5NP2/c1-30-22-34(5)48(35(6)23-30)59(49-36(7)24-31(2)25-37(49)8)20-16-52(58-18-14-13-15-19-58,42-43(53)45(55)47(57)46(56)44(42)54)17-21-60(50-38(9)26-32(3)27-39(50)10)51-40(11)28-33(4)29-41(51)12/h13-15,18-19,22-29H,16-17,20-21H2,1-12H3 |
| InChIKey | QVMKRCVJGNHJAW-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.77 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|