C36H40BF5NP — CID 139159104
2-bis(2,4,6-trimethylphenyl)phosphanylethyl-(2,3,4,5,6-pentafluorophenyl)-[(E)-pent-1-enyl]-pyridin-1-ium-1-ylboranuide (PubChem CID 139159104) has the molecular formula C36H40BF5NP and a molecular weight of 623.50 g/mol. Its IUPAC name is 2-bis(2,4,6-trimethylphenyl)phosphanylethyl-(2,3,4,5,6-pentafluorophenyl)-[(E)-pent-1-enyl]-pyridin-1-ium-1-ylboranuide.
| Compound Name | 2-bis(2,4,6-trimethylphenyl)phosphanylethyl-(2,3,4,5,6-pentafluorophenyl)-[(E)-pent-1-enyl]-pyridin-1-ium-1-ylboranuide |
|---|---|
| PubChem CID | 139159104 |
| Molecular Formula | C36H40BF5NP |
| Molecular Weight | 623.50 g/mol |
| Exact Mass | 623.29 |
| IUPAC Name | 2-bis(2,4,6-trimethylphenyl)phosphanylethyl-(2,3,4,5,6-pentafluorophenyl)-[(E)-pent-1-enyl]-pyridin-1-ium-1-ylboranuide |
| SMILES | CCC/C=C/[B@-](CCP(c1c(C)cc(C)cc1C)c1c(C)cc(C)cc1C)(c1c(F)c(F)c(F)c(F)c1F)[n+]1ccccc1 |
| InChI | InChI=1S/C36H40BF5NP/c1-8-9-11-14-37(43-16-12-10-13-17-43,29-30(38)32(40)34(42)33(41)31(29)39)15-18-44(35-25(4)19-23(2)20-26(35)5)36-27(6)21-24(3)22-28(36)7/h10-14,16-17,19-22H,8-9,15,18H2,1-7H3/b14-11+/t37-/m0/s1 |
| InChIKey | BXACTQIYXMJCAU-UWZWCGGOSA-N |
| XLogP | 8.25 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.50 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|