C37H31BF10NP — CID 139161816
2-bis(2,4,6-trimethylphenyl)phosphanylethyl-bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide (PubChem CID 139161816) has the molecular formula C37H31BF10NP and a molecular weight of 721.43 g/mol. Its IUPAC name is 2-bis(2,4,6-trimethylphenyl)phosphanylethyl-bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide.
| Compound Name | 2-bis(2,4,6-trimethylphenyl)phosphanylethyl-bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide |
|---|---|
| PubChem CID | 139161816 |
| Molecular Formula | C37H31BF10NP |
| Molecular Weight | 721.43 g/mol |
| Exact Mass | 721.21 |
| IUPAC Name | 2-bis(2,4,6-trimethylphenyl)phosphanylethyl-bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide |
| SMILES | Cc1cc(C)c(P(CC[B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)[n+]2ccccc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C37H31BF10NP/c1-18-14-20(3)36(21(4)15-18)50(37-22(5)16-19(2)17-23(37)6)13-10-38(49-11-8-7-9-12-49,24-26(39)30(43)34(47)31(44)27(24)40)25-28(41)32(45)35(48)33(46)29(25)42/h7-9,11-12,14-17H,10,13H2,1-6H3 |
| InChIKey | ZLOGNOWBPSAAON-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.43 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|