C29H21BClF10N — CID 139052701
[1-(2-chloroprop-2-enyl)-3,5-dimethylidenecyclohexyl]methyl-bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide (PubChem CID 139052701) has the molecular formula C29H21BClF10N and a molecular weight of 619.74 g/mol. Its IUPAC name is [1-(2-chloroprop-2-enyl)-3,5-dimethylidenecyclohexyl]methyl-bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide.
| Compound Name | [1-(2-chloroprop-2-enyl)-3,5-dimethylidenecyclohexyl]methyl-bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide |
|---|---|
| PubChem CID | 139052701 |
| Molecular Formula | C29H21BClF10N |
| Molecular Weight | 619.74 g/mol |
| Exact Mass | 619.13 |
| IUPAC Name | [1-(2-chloroprop-2-enyl)-3,5-dimethylidenecyclohexyl]methyl-bis(2,3,4,5,6-pentafluorophenyl)-pyridin-1-ium-1-ylboranuide |
| SMILES | C=C(Cl)CC1(C[B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)[n+]2ccccc2)CC(=C)CC(=C)C1 |
| InChI | InChI=1S/C29H21BClF10N/c1-14-9-15(2)11-29(10-14,12-16(3)31)13-30(42-7-5-4-6-8-42,17-19(32)23(36)27(40)24(37)20(17)33)18-21(34)25(38)28(41)26(39)22(18)35/h4-8H,1-3,9-13H2 |
| InChIKey | PIYDCTYUJASEOS-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.74 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|