C24H32O2 — CID 125306901
(2E,4E,6E)-7-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-methylocta-2,4,6-trienoic acid (PubChem CID 125306901) has the molecular formula C24H32O2 and a molecular weight of 352.52 g/mol. Its IUPAC name is (2E,4E,6E)-7-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-methylocta-2,4,6-trienoic acid.
| Compound Name | (2E,4E,6E)-7-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 125306901 |
| Molecular Formula | C24H32O2 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (2E,4E,6E)-7-(1,1,2,2,3,3-hexamethylinden-5-yl)-3-methylocta-2,4,6-trienoic acid |
| SMILES | CC(/C=C/C=C(\C)c1ccc2c(c1)C(C)(C)C(C)(C)C2(C)C)=C\C(=O)O |
| InChI | InChI=1S/C24H32O2/c1-16(14-21(25)26)10-9-11-17(2)18-12-13-19-20(15-18)23(5,6)24(7,8)22(19,3)4/h9-15H,1-8H3,(H,25,26)/b10-9+,16-14+,17-11+ |
| InChIKey | GVGQZXQAFNUDJB-QOZNPEFCSA-N |
| XLogP | 6.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|