C22H28 — CID 20646486
1,1,4-trimethyl-6-[(2E,4E,6E)-6-methylocta-2,4,6-trien-2-yl]-2H-naphthalene (PubChem CID 20646486) has the molecular formula C22H28 and a molecular weight of 292.47 g/mol. Its IUPAC name is 1,1,4-trimethyl-6-[(2E,4E,6E)-6-methylocta-2,4,6-trien-2-yl]-2H-naphthalene.
| Compound Name | 1,1,4-trimethyl-6-[(2E,4E,6E)-6-methylocta-2,4,6-trien-2-yl]-2H-naphthalene |
|---|---|
| PubChem CID | 20646486 |
| Molecular Formula | C22H28 |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1,1,4-trimethyl-6-[(2E,4E,6E)-6-methylocta-2,4,6-trien-2-yl]-2H-naphthalene |
| SMILES | C/C=C(C)/C=C/C=C(\C)c1ccc2c(c1)C(C)=CCC2(C)C |
| InChI | InChI=1S/C22H28/c1-7-16(2)9-8-10-17(3)19-11-12-21-20(15-19)18(4)13-14-22(21,5)6/h7-13,15H,14H2,1-6H3/b9-8+,16-7+,17-10+ |
| InChIKey | FBZWKAKAYDNDNA-NDWGSUAISA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|