C19H22O2S — CID 54056410
7-(3,3-dimethyl-2H-1-benzothiophen-5-yl)-3-methylocta-2,4,6-trienoic acid (PubChem CID 54056410) has the molecular formula C19H22O2S and a molecular weight of 314.45 g/mol. Its IUPAC name is 7-(3,3-dimethyl-2H-1-benzothiophen-5-yl)-3-methylocta-2,4,6-trienoic acid.
| Compound Name | 7-(3,3-dimethyl-2H-1-benzothiophen-5-yl)-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 54056410 |
| Molecular Formula | C19H22O2S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 7-(3,3-dimethyl-2H-1-benzothiophen-5-yl)-3-methylocta-2,4,6-trienoic acid |
| SMILES | CC(C=CC=C(C)c1ccc2c(c1)C(C)(C)CS2)=CC(=O)O |
| InChI | InChI=1S/C19H22O2S/c1-13(10-18(20)21)6-5-7-14(2)15-8-9-17-16(11-15)19(3,4)12-22-17/h5-11H,12H2,1-4H3,(H,20,21) |
| InChIKey | LWOPJLGICWVJGG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|