C27H40O3 — CID 87625420
ethyl (2E,4E,6E)-7-(3,5-ditert-butyl-2-ethoxyphenyl)-3-methylocta-2,4,6-trienoate (PubChem CID 87625420) has the molecular formula C27H40O3 and a molecular weight of 412.61 g/mol. Its IUPAC name is ethyl (2E,4E,6E)-7-(3,5-ditert-butyl-2-ethoxyphenyl)-3-methylocta-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E,6E)-7-(3,5-ditert-butyl-2-ethoxyphenyl)-3-methylocta-2,4,6-trienoate |
|---|---|
| PubChem CID | 87625420 |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | ethyl (2E,4E,6E)-7-(3,5-ditert-butyl-2-ethoxyphenyl)-3-methylocta-2,4,6-trienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C=C(\C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1OCC |
| InChI | InChI=1S/C27H40O3/c1-11-29-24(28)16-19(3)14-13-15-20(4)22-17-21(26(5,6)7)18-23(27(8,9)10)25(22)30-12-2/h13-18H,11-12H2,1-10H3/b14-13+,19-16+,20-15+ |
| InChIKey | SCSNUXARZTZJSI-KWORTDQBSA-N |
| XLogP | 7.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|