C31H48O3 — CID 85060850
7-(3,5-ditert-butyl-2-octoxyphenyl)-3-methylocta-2,4,6-trienoic acid (PubChem CID 85060850) has the molecular formula C31H48O3 and a molecular weight of 468.72 g/mol. Its IUPAC name is 7-(3,5-ditert-butyl-2-octoxyphenyl)-3-methylocta-2,4,6-trienoic acid.
| Compound Name | 7-(3,5-ditert-butyl-2-octoxyphenyl)-3-methylocta-2,4,6-trienoic acid |
|---|---|
| PubChem CID | 85060850 |
| Molecular Formula | C31H48O3 |
| Molecular Weight | 468.72 g/mol |
| Exact Mass | 468.36 |
| IUPAC Name | 7-(3,5-ditert-butyl-2-octoxyphenyl)-3-methylocta-2,4,6-trienoic acid |
| SMILES | CCCCCCCCOc1c(C(C)=CC=CC(C)=CC(=O)O)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C31H48O3/c1-10-11-12-13-14-15-19-34-29-26(24(3)18-16-17-23(2)20-28(32)33)21-25(30(4,5)6)22-27(29)31(7,8)9/h16-18,20-22H,10-15,19H2,1-9H3,(H,32,33) |
| InChIKey | NUVXRFXEJGJZIJ-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.72 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|