About 1,4-bis(chloromethyl)benzene;2-chloropropan-2-ylbenzene
1,4-bis(chloromethyl)benzene;2-chloropropan-2-ylbenzene (PubChem CID 157434401) has the molecular formula C17H19Cl3
and a molecular weight of 329.70 g/mol. Its IUPAC name is 1,4-bis(chloromethyl)benzene;2-chloropropan-2-ylbenzene.
Molecular Properties
| Compound Name | 1,4-bis(chloromethyl)benzene;2-chloropropan-2-ylbenzene |
| PubChem CID | 157434401 |
| Molecular Formula | C17H19Cl3 |
| Molecular Weight | 329.70 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 1,4-bis(chloromethyl)benzene;2-chloropropan-2-ylbenzene |
| SMILES | CC(C)(Cl)c1ccccc1.ClCc1ccc(CCl)cc1 |
| InChI | InChI=1S/C9H11Cl.C8H8Cl2/c1-9(2,10)8-6-4-3-5-7-8;9-5-7-1-2-8(6-10)4-3-7/h3-7H,1-2H3;1-4H,5-6H2 |
| InChIKey | BQXQZFNANIHATH-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.70 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(chloromethyl)benzene;2-chloropropan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(chloromethyl)benzene;2-chloropropan-2-ylbenzene?
The IUPAC name of 1,4-bis(chloromethyl)benzene;2-chloropropan-2-ylbenzene (CID 157434401) is 1,4-bis(chloromethyl)benzene;2-chloropropan-2-ylbenzene.
What is the SMILES notation for 1,4-bis(chloromethyl)benzene;2-chloropropan-2-ylbenzene?
The canonical SMILES for 1,4-bis(chloromethyl)benzene;2-chloropropan-2-ylbenzene is CC(C)(Cl)c1ccccc1.ClCc1ccc(CCl)cc1.
What is the InChIKey of 1,4-bis(chloromethyl)benzene;2-chloropropan-2-ylbenzene?
The InChIKey is BQXQZFNANIHATH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11Cl.C8H8Cl2/c1-9(2,10)8-6-4-3-5-7-8;9-5-7-1-2-8(6-10)4-3-7/h3-7H,1-2H3;1-4H,5-6H2.
What are the key properties of 1,4-bis(chloromethyl)benzene;2-chloropropan-2-ylbenzene?
1,4-bis(chloromethyl)benzene;2-chloropropan-2-ylbenzene has a molecular weight of 329.70 g/mol, XLogP of 6.32, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(chloromethyl)benzene;2-chloropropan-2-ylbenzene is sourced from PubChem (CID 157434401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).