C17H28 — CID 22369928
(2,5-dimethyl-3-propan-2-ylhexan-3-yl)benzene (PubChem CID 22369928) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is (2,5-dimethyl-3-propan-2-ylhexan-3-yl)benzene.
| Compound Name | (2,5-dimethyl-3-propan-2-ylhexan-3-yl)benzene |
|---|---|
| PubChem CID | 22369928 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | (2,5-dimethyl-3-propan-2-ylhexan-3-yl)benzene |
| SMILES | CC(C)CC(c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H28/c1-13(2)12-17(14(3)4,15(5)6)16-10-8-7-9-11-16/h7-11,13-15H,12H2,1-6H3 |
| InChIKey | WPVVXEVSWQXQGA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |