C19H36 — CID 142581096
2,3-dimethylbutan-2-ylbenzene;ethane;2-methylbutane (PubChem CID 142581096) has the molecular formula C19H36 and a molecular weight of 264.50 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-ylbenzene;ethane;2-methylbutane.
| Compound Name | 2,3-dimethylbutan-2-ylbenzene;ethane;2-methylbutane |
|---|---|
| PubChem CID | 142581096 |
| Molecular Formula | C19H36 |
| Molecular Weight | 264.50 g/mol |
| Exact Mass | 264.28 |
| IUPAC Name | 2,3-dimethylbutan-2-ylbenzene;ethane;2-methylbutane |
| SMILES | CC.CC(C)C(C)(C)c1ccccc1.CCC(C)C |
| InChI | InChI=1S/C12H18.C5H12.C2H6/c1-10(2)12(3,4)11-8-6-5-7-9-11;1-4-5(2)3;1-2/h5-10H,1-4H3;5H,4H2,1-3H3;1-2H3 |
| InChIKey | RZGDLPJOBQNHAI-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.50 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |