About tert-butylbenzene;3-ethyl-2-methylpentane
tert-butylbenzene;3-ethyl-2-methylpentane (PubChem CID 177346689) has the molecular formula C18H32
and a molecular weight of 248.45 g/mol. Its IUPAC name is tert-butylbenzene;3-ethyl-2-methylpentane.
Molecular Properties
| Compound Name | tert-butylbenzene;3-ethyl-2-methylpentane |
| PubChem CID | 177346689 |
| Molecular Formula | C18H32 |
| Molecular Weight | 248.45 g/mol |
| Exact Mass | 248.25 |
| IUPAC Name | tert-butylbenzene;3-ethyl-2-methylpentane |
| SMILES | CC(C)(C)c1ccccc1.CCC(CC)C(C)C |
| InChI | InChI=1S/C10H14.C8H18/c1-10(2,3)9-7-5-4-6-8-9;1-5-8(6-2)7(3)4/h4-8H,1-3H3;7-8H,5-6H2,1-4H3 |
| InChIKey | XDFJXXASQJDMDR-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.45 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tert-butylbenzene;3-ethyl-2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylbenzene;3-ethyl-2-methylpentane?
The IUPAC name of tert-butylbenzene;3-ethyl-2-methylpentane (CID 177346689) is tert-butylbenzene;3-ethyl-2-methylpentane.
What is the SMILES notation for tert-butylbenzene;3-ethyl-2-methylpentane?
The canonical SMILES for tert-butylbenzene;3-ethyl-2-methylpentane is CC(C)(C)c1ccccc1.CCC(CC)C(C)C.
What is the InChIKey of tert-butylbenzene;3-ethyl-2-methylpentane?
The InChIKey is XDFJXXASQJDMDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.C8H18/c1-10(2,3)9-7-5-4-6-8-9;1-5-8(6-2)7(3)4/h4-8H,1-3H3;7-8H,5-6H2,1-4H3.
What are the key properties of tert-butylbenzene;3-ethyl-2-methylpentane?
tert-butylbenzene;3-ethyl-2-methylpentane has a molecular weight of 248.45 g/mol, XLogP of 6.06, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylbenzene;3-ethyl-2-methylpentane is sourced from PubChem (CID 177346689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).