C20H26 — CID 154351099
(3,4-dimethyl-2-phenylhexan-2-yl)benzene (PubChem CID 154351099) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is (3,4-dimethyl-2-phenylhexan-2-yl)benzene.
| Compound Name | (3,4-dimethyl-2-phenylhexan-2-yl)benzene |
|---|---|
| PubChem CID | 154351099 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | (3,4-dimethyl-2-phenylhexan-2-yl)benzene |
| SMILES | CCC(C)C(C)C(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26/c1-5-16(2)17(3)20(4,18-12-8-6-9-13-18)19-14-10-7-11-15-19/h6-17H,5H2,1-4H3 |
| InChIKey | XOKCAIUVHDKSSJ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |