C16H26 — CID 20588991
2,3,6-trimethylheptan-2-ylbenzene (PubChem CID 20588991) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is 2,3,6-trimethylheptan-2-ylbenzene.
| Compound Name | 2,3,6-trimethylheptan-2-ylbenzene |
|---|---|
| PubChem CID | 20588991 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 2,3,6-trimethylheptan-2-ylbenzene |
| SMILES | CC(C)CCC(C)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C16H26/c1-13(2)11-12-14(3)16(4,5)15-9-7-6-8-10-15/h6-10,13-14H,11-12H2,1-5H3 |
| InChIKey | MKIGSBRDLZYREM-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |