C13H20O — CID 12036606
2,4-dimethyl-2-phenyl(313C)pentan-3-ol (PubChem CID 12036606) has the molecular formula C13H20O and a molecular weight of 193.29 g/mol. Its IUPAC name is 2,4-dimethyl-2-phenyl(313C)pentan-3-ol.
| Compound Name | 2,4-dimethyl-2-phenyl(313C)pentan-3-ol |
|---|---|
| PubChem CID | 12036606 |
| Molecular Formula | C13H20O |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 2,4-dimethyl-2-phenyl(313C)pentan-3-ol |
| SMILES | CC(C)[13CH](O)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C13H20O/c1-10(2)12(14)13(3,4)11-8-6-5-7-9-11/h5-10,12,14H,1-4H3/i12+1 |
| InChIKey | FJUKBTZGHVOFMH-HNHCFKFXSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |