C20H26O4 — CID 101412286
(2R,3R,4R,5R)-2,5-dimethoxy-2,5-diphenylhexane-3,4-diol (PubChem CID 101412286) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2,5-dimethoxy-2,5-diphenylhexane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2,5-dimethoxy-2,5-diphenylhexane-3,4-diol |
|---|---|
| PubChem CID | 101412286 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (2R,3R,4R,5R)-2,5-dimethoxy-2,5-diphenylhexane-3,4-diol |
| SMILES | CO[C@](C)(c1ccccc1)[C@H](O)[C@@H](O)[C@](C)(OC)c1ccccc1 |
| InChI | InChI=1S/C20H26O4/c1-19(23-3,15-11-7-5-8-12-15)17(21)18(22)20(2,24-4)16-13-9-6-10-14-16/h5-14,17-18,21-22H,1-4H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | DRYLNCKIDMSVBH-UAFMIMERSA-N |
| XLogP | 2.83 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |