C17H20O2 — CID 3395875
3-methoxy-2,3-diphenylbutan-2-ol (PubChem CID 3395875) has the molecular formula C17H20O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-methoxy-2,3-diphenylbutan-2-ol.
| Compound Name | 3-methoxy-2,3-diphenylbutan-2-ol |
|---|---|
| PubChem CID | 3395875 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 3-methoxy-2,3-diphenylbutan-2-ol |
| SMILES | COC(C)(c1ccccc1)C(C)(O)c1ccccc1 |
| InChI | InChI=1S/C17H20O2/c1-16(18,14-10-6-4-7-11-14)17(2,19-3)15-12-8-5-9-13-15/h4-13,18H,1-3H3 |
| InChIKey | NACJJXQFPDJAQO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |