C32H50O2 — CID 141207627
[2-(4,4-dimethyl-2-phenyl-3-propan-2-ylpentan-2-yl)peroxy-4,4-dimethyl-3-propan-2-ylpentan-2-yl]benzene (PubChem CID 141207627) has the molecular formula C32H50O2 and a molecular weight of 466.75 g/mol. Its IUPAC name is [2-(4,4-dimethyl-2-phenyl-3-propan-2-ylpentan-2-yl)peroxy-4,4-dimethyl-3-propan-2-ylpentan-2-yl]benzene.
| Compound Name | [2-(4,4-dimethyl-2-phenyl-3-propan-2-ylpentan-2-yl)peroxy-4,4-dimethyl-3-propan-2-ylpentan-2-yl]benzene |
|---|---|
| PubChem CID | 141207627 |
| Molecular Formula | C32H50O2 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.38 |
| IUPAC Name | [2-(4,4-dimethyl-2-phenyl-3-propan-2-ylpentan-2-yl)peroxy-4,4-dimethyl-3-propan-2-ylpentan-2-yl]benzene |
| SMILES | CC(C)C(C(C)(C)C)C(C)(OOC(C)(c1ccccc1)C(C(C)C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C32H50O2/c1-23(2)27(29(5,6)7)31(11,25-19-15-13-16-20-25)33-34-32(12,26-21-17-14-18-22-26)28(24(3)4)30(8,9)10/h13-24,27-28H,1-12H3 |
| InChIKey | XAXWCIUWPWBTDS-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|