C14H23N — CID 21032330
N,2,4-trimethyl-2-phenylpentan-3-amine (PubChem CID 21032330) has the molecular formula C14H23N and a molecular weight of 205.35 g/mol. Its IUPAC name is N,2,4-trimethyl-2-phenylpentan-3-amine.
| Compound Name | N,2,4-trimethyl-2-phenylpentan-3-amine |
|---|---|
| PubChem CID | 21032330 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | N,2,4-trimethyl-2-phenylpentan-3-amine |
| SMILES | CNC(C(C)C)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C14H23N/c1-11(2)13(15-5)14(3,4)12-9-7-6-8-10-12/h6-11,13,15H,1-5H3 |
| InChIKey | SMZMBDNJTCJENT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |