C14H19ClO — CID 102467586
(3R,4S)-4-(chloromethyl)-2-methyl-2-phenylhex-5-en-3-ol (PubChem CID 102467586) has the molecular formula C14H19ClO and a molecular weight of 238.76 g/mol. Its IUPAC name is (3R,4S)-4-(chloromethyl)-2-methyl-2-phenylhex-5-en-3-ol.
| Compound Name | (3R,4S)-4-(chloromethyl)-2-methyl-2-phenylhex-5-en-3-ol |
|---|---|
| PubChem CID | 102467586 |
| Molecular Formula | C14H19ClO |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (3R,4S)-4-(chloromethyl)-2-methyl-2-phenylhex-5-en-3-ol |
| SMILES | C=C[C@H](CCl)[C@@H](O)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C14H19ClO/c1-4-11(10-15)13(16)14(2,3)12-8-6-5-7-9-12/h4-9,11,13,16H,1,10H2,2-3H3/t11-,13-/m1/s1 |
| InChIKey | CNPBRGBNUCZSQB-DGCLKSJQSA-N |
| XLogP | 3.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|