C23H32O — CID 175269068
(3-methoxy-2,5,6-trimethyl-6-phenylheptan-2-yl)benzene (PubChem CID 175269068) has the molecular formula C23H32O and a molecular weight of 324.51 g/mol. Its IUPAC name is (3-methoxy-2,5,6-trimethyl-6-phenylheptan-2-yl)benzene.
| Compound Name | (3-methoxy-2,5,6-trimethyl-6-phenylheptan-2-yl)benzene |
|---|---|
| PubChem CID | 175269068 |
| Molecular Formula | C23H32O |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | (3-methoxy-2,5,6-trimethyl-6-phenylheptan-2-yl)benzene |
| SMILES | COC(CC(C)C(C)(C)c1ccccc1)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H32O/c1-18(22(2,3)19-13-9-7-10-14-19)17-21(24-6)23(4,5)20-15-11-8-12-16-20/h7-16,18,21H,17H2,1-6H3 |
| InChIKey | RTRRVEAJLFUQDE-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |