C14H21IO2 — CID 174222430
(4-iodo-4,4-dimethoxy-2,3-dimethylbutan-2-yl)benzene (PubChem CID 174222430) has the molecular formula C14H21IO2 and a molecular weight of 348.22 g/mol. Its IUPAC name is (4-iodo-4,4-dimethoxy-2,3-dimethylbutan-2-yl)benzene.
| Compound Name | (4-iodo-4,4-dimethoxy-2,3-dimethylbutan-2-yl)benzene |
|---|---|
| PubChem CID | 174222430 |
| Molecular Formula | C14H21IO2 |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | (4-iodo-4,4-dimethoxy-2,3-dimethylbutan-2-yl)benzene |
| SMILES | COC(I)(OC)C(C)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C14H21IO2/c1-11(14(15,16-4)17-5)13(2,3)12-9-7-6-8-10-12/h6-11H,1-5H3 |
| InChIKey | DQEKBWMAMYIUEQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|