About ethane;2-methylbutane;triphenylsulfanium
ethane;2-methylbutane;triphenylsulfanium (PubChem CID 165080585) has the molecular formula C29H45S+
and a molecular weight of 425.75 g/mol. Its IUPAC name is ethane;2-methylbutane;triphenylsulfanium.
Molecular Properties
| Compound Name | ethane;2-methylbutane;triphenylsulfanium |
| PubChem CID | 165080585 |
| Molecular Formula | C29H45S+ |
| Molecular Weight | 425.75 g/mol |
| Exact Mass | 425.32 |
| IUPAC Name | ethane;2-methylbutane;triphenylsulfanium |
| SMILES | CC.CC.CC.CCC(C)C.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C5H12.3C2H6/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-5(2)3;3*1-2/h1-15H;5H,4H2,1-3H3;3*1-2H3/q+1;;;; |
| InChIKey | VAUDXRHLQLDQNQ-UHFFFAOYSA-N |
| XLogP | 9.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.75 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylbutane;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylbutane;triphenylsulfanium?
The IUPAC name of ethane;2-methylbutane;triphenylsulfanium (CID 165080585) is ethane;2-methylbutane;triphenylsulfanium.
What is the SMILES notation for ethane;2-methylbutane;triphenylsulfanium?
The canonical SMILES for ethane;2-methylbutane;triphenylsulfanium is CC.CC.CC.CCC(C)C.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of ethane;2-methylbutane;triphenylsulfanium?
The InChIKey is VAUDXRHLQLDQNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15S.C5H12.3C2H6/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-5(2)3;3*1-2/h1-15H;5H,4H2,1-3H3;3*1-2H3/q+1;;;;.
What are the key properties of ethane;2-methylbutane;triphenylsulfanium?
ethane;2-methylbutane;triphenylsulfanium has a molecular weight of 425.75 g/mol, XLogP of 9.91, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylbutane;triphenylsulfanium is sourced from PubChem (CID 165080585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).