C21H34N2 — CID 145412701
1,2-dibenzylhydrazine;ethane;2-methylbutane (PubChem CID 145412701) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is 1,2-dibenzylhydrazine;ethane;2-methylbutane.
| Compound Name | 1,2-dibenzylhydrazine;ethane;2-methylbutane |
|---|---|
| PubChem CID | 145412701 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | 1,2-dibenzylhydrazine;ethane;2-methylbutane |
| SMILES | CC.CCC(C)C.c1ccc(CNNCc2ccccc2)cc1 |
| InChI | InChI=1S/C14H16N2.C5H12.C2H6/c1-3-7-13(8-4-1)11-15-16-12-14-9-5-2-6-10-14;1-4-5(2)3;1-2/h1-10,15-16H,11-12H2;5H,4H2,1-3H3;1-2H3 |
| InChIKey | NCPQAGNLERHJKH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|