C15H26 — CID 142109558
1-(2,3-dimethylbutan-2-yl)-4-methylbenzene;ethane (PubChem CID 142109558) has the molecular formula C15H26 and a molecular weight of 206.37 g/mol. Its IUPAC name is 1-(2,3-dimethylbutan-2-yl)-4-methylbenzene;ethane.
| Compound Name | 1-(2,3-dimethylbutan-2-yl)-4-methylbenzene;ethane |
|---|---|
| PubChem CID | 142109558 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | 1-(2,3-dimethylbutan-2-yl)-4-methylbenzene;ethane |
| SMILES | CC.Cc1ccc(C(C)(C)C(C)C)cc1 |
| InChI | InChI=1S/C13H20.C2H6/c1-10(2)13(4,5)12-8-6-11(3)7-9-12;1-2/h6-10H,1-5H3;1-2H3 |
| InChIKey | SKYXALRERFVTDG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |