C20H26Cl4 — CID 90984706
ethane;1-methyl-4-[1,1,2,2-tetrachloro-2-(4-methylphenyl)ethyl]benzene (PubChem CID 90984706) has the molecular formula C20H26Cl4 and a molecular weight of 408.24 g/mol. Its IUPAC name is ethane;1-methyl-4-[1,1,2,2-tetrachloro-2-(4-methylphenyl)ethyl]benzene.
| Compound Name | ethane;1-methyl-4-[1,1,2,2-tetrachloro-2-(4-methylphenyl)ethyl]benzene |
|---|---|
| PubChem CID | 90984706 |
| Molecular Formula | C20H26Cl4 |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | ethane;1-methyl-4-[1,1,2,2-tetrachloro-2-(4-methylphenyl)ethyl]benzene |
| SMILES | CC.CC.Cc1ccc(C(Cl)(Cl)C(Cl)(Cl)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C16H14Cl4.2C2H6/c1-11-3-7-13(8-4-11)15(17,18)16(19,20)14-9-5-12(2)6-10-14;2*1-2/h3-10H,1-2H3;2*1-2H3 |
| InChIKey | ZQCQBTGZEVJKHH-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|