C10H10Cl6 — CID 174736930
1,1,1,2,2,2-hexachloroethane;1,4-xylene (PubChem CID 174736930) has the molecular formula C10H10Cl6 and a molecular weight of 342.91 g/mol. Its IUPAC name is 1,1,1,2,2,2-hexachloroethane;1,4-xylene.
| Compound Name | 1,1,1,2,2,2-hexachloroethane;1,4-xylene |
|---|---|
| PubChem CID | 174736930 |
| Molecular Formula | C10H10Cl6 |
| Molecular Weight | 342.91 g/mol |
| Exact Mass | 339.89 |
| IUPAC Name | 1,1,1,2,2,2-hexachloroethane;1,4-xylene |
| SMILES | Cc1ccc(C)cc1.ClC(Cl)(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H10.C2Cl6/c1-7-3-5-8(2)6-4-7;3-1(4,5)2(6,7)8/h3-6H,1-2H3; |
| InChIKey | IURHCGZEXFGVCK-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.91 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|