About benzene;tetrachloromethane;toluene
benzene;tetrachloromethane;toluene (PubChem CID 172748154) has the molecular formula C14H14Cl4
and a molecular weight of 324.08 g/mol. Its IUPAC name is benzene;tetrachloromethane;toluene.
Molecular Properties
| Compound Name | benzene;tetrachloromethane;toluene |
| PubChem CID | 172748154 |
| Molecular Formula | C14H14Cl4 |
| Molecular Weight | 324.08 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | benzene;tetrachloromethane;toluene |
| SMILES | Cc1ccccc1.ClC(Cl)(Cl)Cl.c1ccccc1 |
| InChI | InChI=1S/C7H8.C6H6.CCl4/c1-7-5-3-2-4-6-7;1-2-4-6-5-3-1;2-1(3,4)5/h2-6H,1H3;1-6H; |
| InChIKey | JZTCXOKVORJMCD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.08 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze benzene;tetrachloromethane;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;tetrachloromethane;toluene?
The IUPAC name of benzene;tetrachloromethane;toluene (CID 172748154) is benzene;tetrachloromethane;toluene.
What is the SMILES notation for benzene;tetrachloromethane;toluene?
The canonical SMILES for benzene;tetrachloromethane;toluene is Cc1ccccc1.ClC(Cl)(Cl)Cl.c1ccccc1.
What is the InChIKey of benzene;tetrachloromethane;toluene?
The InChIKey is JZTCXOKVORJMCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8.C6H6.CCl4/c1-7-5-3-2-4-6-7;1-2-4-6-5-3-1;2-1(3,4)5/h2-6H,1H3;1-6H;.
What are the key properties of benzene;tetrachloromethane;toluene?
benzene;tetrachloromethane;toluene has a molecular weight of 324.08 g/mol, XLogP of 6.23, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;tetrachloromethane;toluene is sourced from PubChem (CID 172748154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).