C12H16F2 — CID 146551648
1-(2,3-dimethylbutan-2-yl)-3,5-difluorobenzene (PubChem CID 146551648) has the molecular formula C12H16F2 and a molecular weight of 198.26 g/mol. Its IUPAC name is 1-(2,3-dimethylbutan-2-yl)-3,5-difluorobenzene.
| Compound Name | 1-(2,3-dimethylbutan-2-yl)-3,5-difluorobenzene |
|---|---|
| PubChem CID | 146551648 |
| Molecular Formula | C12H16F2 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1-(2,3-dimethylbutan-2-yl)-3,5-difluorobenzene |
| SMILES | CC(C)C(C)(C)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H16F2/c1-8(2)12(3,4)9-5-10(13)7-11(14)6-9/h5-8H,1-4H3 |
| InChIKey | IYZVGDBSRHRGOX-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |