C13H19FO — CID 115401195
2-(3-fluoro-5-methylphenyl)-3,3-dimethylbutan-2-ol (PubChem CID 115401195) has the molecular formula C13H19FO and a molecular weight of 210.29 g/mol. Its IUPAC name is 2-(3-fluoro-5-methylphenyl)-3,3-dimethylbutan-2-ol.
| Compound Name | 2-(3-fluoro-5-methylphenyl)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 115401195 |
| Molecular Formula | C13H19FO |
| Molecular Weight | 210.29 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-(3-fluoro-5-methylphenyl)-3,3-dimethylbutan-2-ol |
| SMILES | Cc1cc(F)cc(C(C)(O)C(C)(C)C)c1 |
| InChI | InChI=1S/C13H19FO/c1-9-6-10(8-11(14)7-9)13(5,15)12(2,3)4/h6-8,15H,1-5H3 |
| InChIKey | ANWZNDHGENPIFU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |