C15H14F2O — CID 62786600
1-(3,5-difluorophenyl)-1-(3-methylphenyl)ethanol (PubChem CID 62786600) has the molecular formula C15H14F2O and a molecular weight of 248.27 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-1-(3-methylphenyl)ethanol.
| Compound Name | 1-(3,5-difluorophenyl)-1-(3-methylphenyl)ethanol |
|---|---|
| PubChem CID | 62786600 |
| Molecular Formula | C15H14F2O |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-(3,5-difluorophenyl)-1-(3-methylphenyl)ethanol |
| SMILES | Cc1cccc(C(C)(O)c2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C15H14F2O/c1-10-4-3-5-11(6-10)15(2,18)12-7-13(16)9-14(17)8-12/h3-9,18H,1-2H3 |
| InChIKey | FPOMWSXLBJQIIM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |