C17H19FO — CID 79692579
1-(3,4-dimethylphenyl)-1-(3-fluoro-5-methylphenyl)ethanol (PubChem CID 79692579) has the molecular formula C17H19FO and a molecular weight of 258.34 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-1-(3-fluoro-5-methylphenyl)ethanol.
| Compound Name | 1-(3,4-dimethylphenyl)-1-(3-fluoro-5-methylphenyl)ethanol |
|---|---|
| PubChem CID | 79692579 |
| Molecular Formula | C17H19FO |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-1-(3-fluoro-5-methylphenyl)ethanol |
| SMILES | Cc1cc(F)cc(C(C)(O)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C17H19FO/c1-11-7-15(10-16(18)8-11)17(4,19)14-6-5-12(2)13(3)9-14/h5-10,19H,1-4H3 |
| InChIKey | BNZRZUHQRHBFDL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |