C15H24O — CID 125487298
(3S)-2,3,4-trimethyl-4-(4-methylphenyl)pentan-2-ol (PubChem CID 125487298) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is (3S)-2,3,4-trimethyl-4-(4-methylphenyl)pentan-2-ol.
| Compound Name | (3S)-2,3,4-trimethyl-4-(4-methylphenyl)pentan-2-ol |
|---|---|
| PubChem CID | 125487298 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | (3S)-2,3,4-trimethyl-4-(4-methylphenyl)pentan-2-ol |
| SMILES | Cc1ccc(C(C)(C)[C@H](C)C(C)(C)O)cc1 |
| InChI | InChI=1S/C15H24O/c1-11-7-9-13(10-8-11)14(3,4)12(2)15(5,6)16/h7-10,12,16H,1-6H3/t12-/m0/s1 |
| InChIKey | LWSZJFJWNOKIIG-LBPRGKRZSA-N |
| XLogP | 3.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |