C18H26O2Si2 — CID 15466235
3-(2-methoxyphenyl)-1,5-bis(trimethylsilyl)penta-1,4-diyn-3-ol (PubChem CID 15466235) has the molecular formula C18H26O2Si2 and a molecular weight of 330.58 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1,5-bis(trimethylsilyl)penta-1,4-diyn-3-ol.
| Compound Name | 3-(2-methoxyphenyl)-1,5-bis(trimethylsilyl)penta-1,4-diyn-3-ol |
|---|---|
| PubChem CID | 15466235 |
| Molecular Formula | C18H26O2Si2 |
| Molecular Weight | 330.58 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 3-(2-methoxyphenyl)-1,5-bis(trimethylsilyl)penta-1,4-diyn-3-ol |
| SMILES | COc1ccccc1C(O)(C#C[Si](C)(C)C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C18H26O2Si2/c1-20-17-11-9-8-10-16(17)18(19,12-14-21(2,3)4)13-15-22(5,6)7/h8-11,19H,1-7H3 |
| InChIKey | BSLHDCPUSHKAHN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|