C19H28F2Si — CID 134951108
[3,3-difluoro-3-(2-methylphenyl)prop-1-ynyl]-tri(propan-2-yl)silane (PubChem CID 134951108) has the molecular formula C19H28F2Si and a molecular weight of 322.51 g/mol. Its IUPAC name is [3,3-difluoro-3-(2-methylphenyl)prop-1-ynyl]-tri(propan-2-yl)silane.
| Compound Name | [3,3-difluoro-3-(2-methylphenyl)prop-1-ynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 134951108 |
| Molecular Formula | C19H28F2Si |
| Molecular Weight | 322.51 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | [3,3-difluoro-3-(2-methylphenyl)prop-1-ynyl]-tri(propan-2-yl)silane |
| SMILES | Cc1ccccc1C(F)(F)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H28F2Si/c1-14(2)22(15(3)4,16(5)6)13-12-19(20,21)18-11-9-8-10-17(18)7/h8-11,14-16H,1-7H3 |
| InChIKey | VUHMFRKIIYOHJI-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.51 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|