C16H26OSi2 — CID 10401990
1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol (PubChem CID 10401990) has the molecular formula C16H26OSi2 and a molecular weight of 290.56 g/mol. Its IUPAC name is 1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol.
| Compound Name | 1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol |
|---|---|
| PubChem CID | 10401990 |
| Molecular Formula | C16H26OSi2 |
| Molecular Weight | 290.56 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol |
| SMILES | C[Si](C)(C)C#CCC(O)(c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C16H26OSi2/c1-18(2,3)14-10-13-16(17,19(4,5)6)15-11-8-7-9-12-15/h7-9,11-12,17H,13H2,1-6H3 |
| InChIKey | LZJKEQPBDXJRDE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|