About 1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol
1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol (PubChem CID 10401990) has the molecular formula C16H26OSi2
and a molecular weight of 290.56 g/mol. Its IUPAC name is 1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol.
Molecular Properties
| Compound Name | 1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol |
| PubChem CID | 10401990 |
| Molecular Formula | C16H26OSi2 |
| Molecular Weight | 290.56 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol |
| SMILES | C[Si](C)(C)C#CCC(O)(c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C16H26OSi2/c1-18(2,3)14-10-13-16(17,19(4,5)6)15-11-8-7-9-12-15/h7-9,11-12,17H,13H2,1-6H3 |
| InChIKey | LZJKEQPBDXJRDE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.56 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol?
The IUPAC name of 1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol (CID 10401990) is 1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol.
What is the SMILES notation for 1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol?
The canonical SMILES for 1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol is C[Si](C)(C)C#CCC(O)(c1ccccc1)[Si](C)(C)C.
What is the InChIKey of 1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol?
The InChIKey is LZJKEQPBDXJRDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26OSi2/c1-18(2,3)14-10-13-16(17,19(4,5)6)15-11-8-7-9-12-15/h7-9,11-12,17H,13H2,1-6H3.
What are the key properties of 1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol?
1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol has a molecular weight of 290.56 g/mol, XLogP of 4.02, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-1,4-bis(trimethylsilyl)but-3-yn-1-ol is sourced from PubChem (CID 10401990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).