C34H40Cl2P2PtSi+2 — CID 6394462
dichloroplatinum;[2-(diphenylphosphaniumylmethyl)-2-methyl-5-trimethylsilylpent-4-ynyl]-diphenylphosphanium (PubChem CID 6394462) has the molecular formula C34H40Cl2P2PtSi+2 and a molecular weight of 804.71 g/mol. Its IUPAC name is dichloroplatinum;[2-(diphenylphosphaniumylmethyl)-2-methyl-5-trimethylsilylpent-4-ynyl]-diphenylphosphanium.
| Compound Name | dichloroplatinum;[2-(diphenylphosphaniumylmethyl)-2-methyl-5-trimethylsilylpent-4-ynyl]-diphenylphosphanium |
|---|---|
| PubChem CID | 6394462 |
| Molecular Formula | C34H40Cl2P2PtSi+2 |
| Molecular Weight | 804.71 g/mol |
| Exact Mass | 803.14 |
| IUPAC Name | dichloroplatinum;[2-(diphenylphosphaniumylmethyl)-2-methyl-5-trimethylsilylpent-4-ynyl]-diphenylphosphanium |
| SMILES | CC(CC#C[Si](C)(C)C)(C[PH+](c1ccccc1)c1ccccc1)C[PH+](c1ccccc1)c1ccccc1.Cl[Pt]Cl |
| InChI | InChI=1S/C34H38P2Si.2ClH.Pt/c1-34(26-17-27-37(2,3)4,28-35(30-18-9-5-10-19-30)31-20-11-6-12-21-31)29-36(32-22-13-7-14-23-32)33-24-15-8-16-25-33;;;/h5-16,18-25H,26,28-29H2,1-4H3;2*1H;/q;;;+2 |
| InChIKey | PRHUIEFKOVZGIQ-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.71 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|