C28H31MnP2Si+ — CID 135023646
(diphenylphosphaniumylmethyl-methanidyl-methylsilyl)methyl-diphenylphosphanium;manganese (PubChem CID 135023646) has the molecular formula C28H31MnP2Si+ and a molecular weight of 512.53 g/mol. Its IUPAC name is (diphenylphosphaniumylmethyl-methanidyl-methylsilyl)methyl-diphenylphosphanium;manganese.
| Compound Name | (diphenylphosphaniumylmethyl-methanidyl-methylsilyl)methyl-diphenylphosphanium;manganese |
|---|---|
| PubChem CID | 135023646 |
| Molecular Formula | C28H31MnP2Si+ |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.10 |
| IUPAC Name | (diphenylphosphaniumylmethyl-methanidyl-methylsilyl)methyl-diphenylphosphanium;manganese |
| SMILES | [CH2-][Si](C)(C[PH+](c1ccccc1)c1ccccc1)C[PH+](c1ccccc1)c1ccccc1.[Mn] |
| InChI | InChI=1S/C28H29P2Si.Mn/c1-31(2,23-29(25-15-7-3-8-16-25)26-17-9-4-10-18-26)24-30(27-19-11-5-12-20-27)28-21-13-6-14-22-28;/h3-22H,1,23-24H2,2H3;/q-1;/p+2 |
| InChIKey | FYBPMZCYAJVSBF-UHFFFAOYSA-P |
| XLogP | 5.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|