C59H71NO7Si2 — CID 102335529
6,9-dimethoxy-3-(4-methoxyphenyl)-12-(4-nitrophenyl)-6,9-diphenyl-1,14-bis[tri(propan-2-yl)silyl]tetradeca-1,4,7,10,13-pentayne-3,12-diol (PubChem CID 102335529) has the molecular formula C59H71NO7Si2 and a molecular weight of 962.39 g/mol. Its IUPAC name is 6,9-dimethoxy-3-(4-methoxyphenyl)-12-(4-nitrophenyl)-6,9-diphenyl-1,14-bis[tri(propan-2-yl)silyl]tetradeca-1,4,7,10,13-pentayne-3,12-diol.
| Compound Name | 6,9-dimethoxy-3-(4-methoxyphenyl)-12-(4-nitrophenyl)-6,9-diphenyl-1,14-bis[tri(propan-2-yl)silyl]tetradeca-1,4,7,10,13-pentayne-3,12-diol |
|---|---|
| PubChem CID | 102335529 |
| Molecular Formula | C59H71NO7Si2 |
| Molecular Weight | 962.39 g/mol |
| Exact Mass | 961.48 |
| IUPAC Name | 6,9-dimethoxy-3-(4-methoxyphenyl)-12-(4-nitrophenyl)-6,9-diphenyl-1,14-bis[tri(propan-2-yl)silyl]tetradeca-1,4,7,10,13-pentayne-3,12-diol |
| SMILES | COc1ccc(C(O)(C#CC(C#CC(C#CC(O)(C#C[Si](C(C)C)(C(C)C)C(C)C)c2ccc([N+](=O)[O-])cc2)(OC)c2ccccc2)(OC)c2ccccc2)C#C[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C59H71NO7Si2/c1-44(2)68(45(3)4,46(5)6)42-40-56(61,50-26-30-54(31-27-50)60(63)64)34-36-58(66-14,52-22-18-16-19-23-52)38-39-59(67-15,53-24-20-17-21-25-53)37-35-57(62,51-28-32-55(65-13)33-29-51)41-43-69(47(7)8,48(9)10)49(11)12/h16-33,44-49,61-62H,1-15H3 |
| InChIKey | UWWLUSVZPWFFAP-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.39 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|