C33H35N2O8P — CID 139702245
[3-[1-[(4-methoxyphenyl)-diphenylmethoxy]ethylamino]-1-(4-nitrophenyl)-4-oxopentan-2-yl]phosphonic acid (PubChem CID 139702245) has the molecular formula C33H35N2O8P and a molecular weight of 618.62 g/mol. Its IUPAC name is [3-[1-[(4-methoxyphenyl)-diphenylmethoxy]ethylamino]-1-(4-nitrophenyl)-4-oxopentan-2-yl]phosphonic acid.
| Compound Name | [3-[1-[(4-methoxyphenyl)-diphenylmethoxy]ethylamino]-1-(4-nitrophenyl)-4-oxopentan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 139702245 |
| Molecular Formula | C33H35N2O8P |
| Molecular Weight | 618.62 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | [3-[1-[(4-methoxyphenyl)-diphenylmethoxy]ethylamino]-1-(4-nitrophenyl)-4-oxopentan-2-yl]phosphonic acid |
| SMILES | COc1ccc(C(OC(C)NC(C(C)=O)C(Cc2ccc([N+](=O)[O-])cc2)P(=O)(O)O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H35N2O8P/c1-23(36)32(31(44(39,40)41)22-25-14-18-29(19-15-25)35(37)38)34-24(2)43-33(26-10-6-4-7-11-26,27-12-8-5-9-13-27)28-16-20-30(42-3)21-17-28/h4-21,24,31-32,34H,22H2,1-3H3,(H2,39,40,41) |
| InChIKey | CVNDPGWFJUHQPM-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.62 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|