C25H26Si — CID 11210438
tert-butyl-diphenyl-(1-phenylpropa-1,2-dienyl)silane (PubChem CID 11210438) has the molecular formula C25H26Si and a molecular weight of 354.57 g/mol. Its IUPAC name is tert-butyl-diphenyl-(1-phenylpropa-1,2-dienyl)silane.
| Compound Name | tert-butyl-diphenyl-(1-phenylpropa-1,2-dienyl)silane |
|---|---|
| PubChem CID | 11210438 |
| Molecular Formula | C25H26Si |
| Molecular Weight | 354.57 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | tert-butyl-diphenyl-(1-phenylpropa-1,2-dienyl)silane |
| SMILES | C=C=C(c1ccccc1)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H26Si/c1-5-24(21-15-9-6-10-16-21)26(25(2,3)4,22-17-11-7-12-18-22)23-19-13-8-14-20-23/h6-20H,1H2,2-4H3 |
| InChIKey | DEMRVOPQGCNYPT-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|